C19H18 — CID 140796680
2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)naphthalene (PubChem CID 140796680) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)naphthalene.
| Compound Name | 2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)naphthalene |
|---|---|
| PubChem CID | 140796680 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)naphthalene |
| SMILES | C1=CC2CC(c3ccc4ccccc4c3)CC2C=C1 |
| InChI | InChI=1S/C19H18/c1-2-6-15-11-18(10-9-14(15)5-1)19-12-16-7-3-4-8-17(16)13-19/h1-11,16-17,19H,12-13H2 |
| InChIKey | UAPXDYPYLKYMSI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |