C17H20N6 — CID 123985217
2-amino-N-(1,4-diamino-3-phenyliminobutylidene)benzenecarboximidamide (PubChem CID 123985217) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-amino-N-(1,4-diamino-3-phenyliminobutylidene)benzenecarboximidamide.
| Compound Name | 2-amino-N-(1,4-diamino-3-phenyliminobutylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 123985217 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-amino-N-(1,4-diamino-3-phenyliminobutylidene)benzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N)C/C(CN)=N\c1ccccc1)c1ccccc1N |
| InChI | InChI=1S/C17H20N6/c18-11-13(22-12-6-2-1-3-7-12)10-16(20)23-17(21)14-8-4-5-9-15(14)19/h1-9H,10-11,18-19H2,(H3,20,21,23)/b22-13+ |
| InChIKey | PZJCLNLDSPFLJI-LPYMAVHISA-N |
| XLogP | 2.07 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|