C28H44N3O4+ — CID 123986277
1-[2-(6-azoniaspiro[5.9]pentadecan-5-yl)-2-oxoethyl]-5-(cyclohexen-1-yl)-3,5-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 123986277) has the molecular formula C28H44N3O4+ and a molecular weight of 486.68 g/mol. Its IUPAC name is 1-[2-(6-azoniaspiro[5.9]pentadecan-5-yl)-2-oxoethyl]-5-(cyclohexen-1-yl)-3,5-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-(6-azoniaspiro[5.9]pentadecan-5-yl)-2-oxoethyl]-5-(cyclohexen-1-yl)-3,5-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 123986277 |
| Molecular Formula | C28H44N3O4+ |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 1-[2-(6-azoniaspiro[5.9]pentadecan-5-yl)-2-oxoethyl]-5-(cyclohexen-1-yl)-3,5-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(CC(=O)C2CCCC[N+]23CCCCCCCCC3)C(=O)C(C)(C2=CCCCC2)C1=O |
| InChI | InChI=1S/C28H44N3O4/c1-28(22-15-9-8-10-16-22)25(33)29(2)27(35)30(26(28)34)21-24(32)23-17-11-14-20-31(23)18-12-6-4-3-5-7-13-19-31/h15,23H,3-14,16-21H2,1-2H3/q+1 |
| InChIKey | GSXKYRJVICIPSE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|