C15H17N3O4 — CID 123986700
2-[4-(4-amino-2-methoxyanilino)-2,5-dihydroxyanilino]acetaldehyde (PubChem CID 123986700) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[4-(4-amino-2-methoxyanilino)-2,5-dihydroxyanilino]acetaldehyde.
| Compound Name | 2-[4-(4-amino-2-methoxyanilino)-2,5-dihydroxyanilino]acetaldehyde |
|---|---|
| PubChem CID | 123986700 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[4-(4-amino-2-methoxyanilino)-2,5-dihydroxyanilino]acetaldehyde |
| SMILES | COc1cc(N)ccc1Nc1cc(O)c(NCC=O)cc1O |
| InChI | InChI=1S/C15H17N3O4/c1-22-15-6-9(16)2-3-10(15)18-12-8-13(20)11(7-14(12)21)17-4-5-19/h2-3,5-8,17-18,20-21H,4,16H2,1H3 |
| InChIKey | KPSTXRSHEVKUOK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|