C14H15N3O3 — CID 123625916
2-[4-(4-aminoanilino)-2,5-dihydroxyanilino]acetaldehyde (PubChem CID 123625916) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[4-(4-aminoanilino)-2,5-dihydroxyanilino]acetaldehyde.
| Compound Name | 2-[4-(4-aminoanilino)-2,5-dihydroxyanilino]acetaldehyde |
|---|---|
| PubChem CID | 123625916 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[4-(4-aminoanilino)-2,5-dihydroxyanilino]acetaldehyde |
| SMILES | Nc1ccc(Nc2cc(O)c(NCC=O)cc2O)cc1 |
| InChI | InChI=1S/C14H15N3O3/c15-9-1-3-10(4-2-9)17-12-8-13(19)11(7-14(12)20)16-5-6-18/h1-4,6-8,16-17,19-20H,5,15H2 |
| InChIKey | CUXCRCKNLWQCNW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|