C36H45N7O3 — CID 123988308
4-[3-[2-[[[4-(aminomethyl)cyclohexyl]-hydroxymethyl]amino]-3-(1H-indazol-6-ylamino)-3-oxopropyl]phenyl]-N-piperidin-4-ylbenzamide (PubChem CID 123988308) has the molecular formula C36H45N7O3 and a molecular weight of 623.80 g/mol. Its IUPAC name is 4-[3-[2-[[[4-(aminomethyl)cyclohexyl]-hydroxymethyl]amino]-3-(1H-indazol-6-ylamino)-3-oxopropyl]phenyl]-N-piperidin-4-ylbenzamide.
| Compound Name | 4-[3-[2-[[[4-(aminomethyl)cyclohexyl]-hydroxymethyl]amino]-3-(1H-indazol-6-ylamino)-3-oxopropyl]phenyl]-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 123988308 |
| Molecular Formula | C36H45N7O3 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.36 |
| IUPAC Name | 4-[3-[2-[[[4-(aminomethyl)cyclohexyl]-hydroxymethyl]amino]-3-(1H-indazol-6-ylamino)-3-oxopropyl]phenyl]-N-piperidin-4-ylbenzamide |
| SMILES | NCC1CCC(C(O)NC(Cc2cccc(-c3ccc(C(=O)NC4CCNCC4)cc3)c2)C(=O)Nc2ccc3cn[nH]c3c2)CC1 |
| InChI | InChI=1S/C36H45N7O3/c37-21-23-4-6-26(7-5-23)35(45)42-33(36(46)41-31-13-12-29-22-39-43-32(29)20-31)19-24-2-1-3-28(18-24)25-8-10-27(11-9-25)34(44)40-30-14-16-38-17-15-30/h1-3,8-13,18,20,22-23,26,30,33,35,38,42,45H,4-7,14-17,19,21,37H2,(H,39,43)(H,40,44)(H,41,46) |
| InChIKey | VOVYBVBFMPBALG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 157.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|