C39H47N5O3 — CID 148680651
(2R)-4-[4-(aminomethyl)cyclohexyl]-N-(1H-indazol-6-yl)-2-[[4-[2-methyl-4-(2-piperidin-4-ylacetyl)phenyl]phenyl]methyl]-4-oxobutanamide (PubChem CID 148680651) has the molecular formula C39H47N5O3 and a molecular weight of 633.84 g/mol. Its IUPAC name is (2R)-4-[4-(aminomethyl)cyclohexyl]-N-(1H-indazol-6-yl)-2-[[4-[2-methyl-4-(2-piperidin-4-ylacetyl)phenyl]phenyl]methyl]-4-oxobutanamide.
| Compound Name | (2R)-4-[4-(aminomethyl)cyclohexyl]-N-(1H-indazol-6-yl)-2-[[4-[2-methyl-4-(2-piperidin-4-ylacetyl)phenyl]phenyl]methyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 148680651 |
| Molecular Formula | C39H47N5O3 |
| Molecular Weight | 633.84 g/mol |
| Exact Mass | 633.37 |
| IUPAC Name | (2R)-4-[4-(aminomethyl)cyclohexyl]-N-(1H-indazol-6-yl)-2-[[4-[2-methyl-4-(2-piperidin-4-ylacetyl)phenyl]phenyl]methyl]-4-oxobutanamide |
| SMILES | Cc1cc(C(=O)CC2CCNCC2)ccc1-c1ccc(C[C@H](CC(=O)C2CCC(CN)CC2)C(=O)Nc2ccc3cn[nH]c3c2)cc1 |
| InChI | InChI=1S/C39H47N5O3/c1-25-18-31(37(45)20-27-14-16-41-17-15-27)11-13-35(25)29-6-2-26(3-7-29)19-33(21-38(46)30-8-4-28(23-40)5-9-30)39(47)43-34-12-10-32-24-42-44-36(32)22-34/h2-3,6-7,10-13,18,22,24,27-28,30,33,41H,4-5,8-9,14-17,19-21,23,40H2,1H3,(H,42,44)(H,43,47)/t28?,30?,33-/m1/s1 |
| InChIKey | NRNKBTYDJKNNNS-HBDLUKAESA-N |
| XLogP | 6.63 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.84 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |