C39H46N4O5 — CID 146779405
4-[4-[(2R)-4-[4-(aminomethyl)cyclohexyl]-4-oxo-2-[(2-oxo-3H-1-benzofuran-6-yl)carbamoyl]butyl]phenyl]-3-methyl-N-piperidin-4-ylbenzamide (PubChem CID 146779405) has the molecular formula C39H46N4O5 and a molecular weight of 650.82 g/mol. Its IUPAC name is 4-[4-[(2R)-4-[4-(aminomethyl)cyclohexyl]-4-oxo-2-[(2-oxo-3H-1-benzofuran-6-yl)carbamoyl]butyl]phenyl]-3-methyl-N-piperidin-4-ylbenzamide.
| Compound Name | 4-[4-[(2R)-4-[4-(aminomethyl)cyclohexyl]-4-oxo-2-[(2-oxo-3H-1-benzofuran-6-yl)carbamoyl]butyl]phenyl]-3-methyl-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 146779405 |
| Molecular Formula | C39H46N4O5 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | 4-[4-[(2R)-4-[4-(aminomethyl)cyclohexyl]-4-oxo-2-[(2-oxo-3H-1-benzofuran-6-yl)carbamoyl]butyl]phenyl]-3-methyl-N-piperidin-4-ylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CCNCC2)ccc1-c1ccc(C[C@H](CC(=O)C2CCC(CN)CC2)C(=O)Nc2ccc3c(c2)OC(=O)C3)cc1 |
| InChI | InChI=1S/C39H46N4O5/c1-24-18-30(38(46)42-32-14-16-41-17-15-32)11-13-34(24)27-6-2-25(3-7-27)19-31(20-35(44)28-8-4-26(23-40)5-9-28)39(47)43-33-12-10-29-21-37(45)48-36(29)22-33/h2-3,6-7,10-13,18,22,26,28,31-32,41H,4-5,8-9,14-17,19-21,23,40H2,1H3,(H,42,46)(H,43,47)/t26?,28?,31-/m1/s1 |
| InChIKey | RTJGYIVGDBJLJN-QBDWVEDRSA-N |
| XLogP | 5.13 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|