C37H46N8O4S — CID 158482576
(2R)-4-[4-(aminomethyl)cyclohexyl]-2-[[4-[2-methyl-4-(piperidin-4-ylsulfamoyl)phenyl]phenyl]methyl]-4-oxo-N-[4-(2H-tetrazol-5-yl)phenyl]butanamide (PubChem CID 158482576) has the molecular formula C37H46N8O4S and a molecular weight of 698.89 g/mol. Its IUPAC name is (2R)-4-[4-(aminomethyl)cyclohexyl]-2-[[4-[2-methyl-4-(piperidin-4-ylsulfamoyl)phenyl]phenyl]methyl]-4-oxo-N-[4-(2H-tetrazol-5-yl)phenyl]butanamide.
| Compound Name | (2R)-4-[4-(aminomethyl)cyclohexyl]-2-[[4-[2-methyl-4-(piperidin-4-ylsulfamoyl)phenyl]phenyl]methyl]-4-oxo-N-[4-(2H-tetrazol-5-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 158482576 |
| Molecular Formula | C37H46N8O4S |
| Molecular Weight | 698.89 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | (2R)-4-[4-(aminomethyl)cyclohexyl]-2-[[4-[2-methyl-4-(piperidin-4-ylsulfamoyl)phenyl]phenyl]methyl]-4-oxo-N-[4-(2H-tetrazol-5-yl)phenyl]butanamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCNCC2)ccc1-c1ccc(C[C@H](CC(=O)C2CCC(CN)CC2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)cc1 |
| InChI | InChI=1S/C37H46N8O4S/c1-24-20-33(50(48,49)43-32-16-18-39-19-17-32)14-15-34(24)27-6-2-25(3-7-27)21-30(22-35(46)28-8-4-26(23-38)5-9-28)37(47)40-31-12-10-29(11-13-31)36-41-44-45-42-36/h2-3,6-7,10-15,20,26,28,30,32,39,43H,4-5,8-9,16-19,21-23,38H2,1H3,(H,40,47)(H,41,42,44,45)/t26?,28?,30-/m1/s1 |
| InChIKey | HHRULHCNFHIQGJ-IEZXHERLSA-N |
| XLogP | 4.39 |
| TPSA | 184.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |