C37H45N7O4 — CID 153133576
tert-butyl N-[[4-[(3R)-3-[[3-(4-amino-2-methylphenyl)phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate (PubChem CID 153133576) has the molecular formula C37H45N7O4 and a molecular weight of 651.81 g/mol. Its IUPAC name is tert-butyl N-[[4-[(3R)-3-[[3-(4-amino-2-methylphenyl)phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(3R)-3-[[3-(4-amino-2-methylphenyl)phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 153133576 |
| Molecular Formula | C37H45N7O4 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.35 |
| IUPAC Name | tert-butyl N-[[4-[(3R)-3-[[3-(4-amino-2-methylphenyl)phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate |
| SMILES | Cc1cc(N)ccc1-c1cccc(C[C@H](CC(=O)C2CCC(CNC(=O)OC(C)(C)C)CC2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)c1 |
| InChI | InChI=1S/C37H45N7O4/c1-23-18-30(38)14-17-32(23)28-7-5-6-25(19-28)20-29(35(46)40-31-15-12-27(13-16-31)34-41-43-44-42-34)21-33(45)26-10-8-24(9-11-26)22-39-36(47)48-37(2,3)4/h5-7,12-19,24,26,29H,8-11,20-22,38H2,1-4H3,(H,39,47)(H,40,46)(H,41,42,43,44)/t24?,26?,29-/m1/s1 |
| InChIKey | VXFIIAGNGZYRMB-LXNFMVHRSA-N |
| XLogP | 6.51 |
| TPSA | 164.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|