C34H37FN6O3 — CID 158814904
(2R)-4-[4-(aminomethyl)cyclohexyl]-2-[[3-(2-fluoro-5-propanoylphenyl)phenyl]methyl]-4-oxo-N-[4-(2H-tetrazol-5-yl)phenyl]butanamide (PubChem CID 158814904) has the molecular formula C34H37FN6O3 and a molecular weight of 596.71 g/mol. Its IUPAC name is (2R)-4-[4-(aminomethyl)cyclohexyl]-2-[[3-(2-fluoro-5-propanoylphenyl)phenyl]methyl]-4-oxo-N-[4-(2H-tetrazol-5-yl)phenyl]butanamide.
| Compound Name | (2R)-4-[4-(aminomethyl)cyclohexyl]-2-[[3-(2-fluoro-5-propanoylphenyl)phenyl]methyl]-4-oxo-N-[4-(2H-tetrazol-5-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 158814904 |
| Molecular Formula | C34H37FN6O3 |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | (2R)-4-[4-(aminomethyl)cyclohexyl]-2-[[3-(2-fluoro-5-propanoylphenyl)phenyl]methyl]-4-oxo-N-[4-(2H-tetrazol-5-yl)phenyl]butanamide |
| SMILES | CCC(=O)c1ccc(F)c(-c2cccc(C[C@H](CC(=O)C3CCC(CN)CC3)C(=O)Nc3ccc(-c4nn[nH]n4)cc3)c2)c1 |
| InChI | InChI=1S/C34H37FN6O3/c1-2-31(42)26-12-15-30(35)29(18-26)25-5-3-4-22(16-25)17-27(19-32(43)23-8-6-21(20-36)7-9-23)34(44)37-28-13-10-24(11-14-28)33-38-40-41-39-33/h3-5,10-16,18,21,23,27H,2,6-9,17,19-20,36H2,1H3,(H,37,44)(H,38,39,40,41)/t21?,23?,27-/m1/s1 |
| InChIKey | IVDJZJTYZUPJKX-AISLOGHRSA-N |
| XLogP | 5.79 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |