C39H49N7O6 — CID 161278176
4-[3-[(2R)-4-[4-(aminomethyl)cyclohexyl]-4-oxo-2-[[4-(2H-tetrazol-5-yl)phenyl]carbamoyl]butyl]phenyl]-N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3-methylbenzamide (PubChem CID 161278176) has the molecular formula C39H49N7O6 and a molecular weight of 711.86 g/mol. Its IUPAC name is 4-[3-[(2R)-4-[4-(aminomethyl)cyclohexyl]-4-oxo-2-[[4-(2H-tetrazol-5-yl)phenyl]carbamoyl]butyl]phenyl]-N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3-methylbenzamide.
| Compound Name | 4-[3-[(2R)-4-[4-(aminomethyl)cyclohexyl]-4-oxo-2-[[4-(2H-tetrazol-5-yl)phenyl]carbamoyl]butyl]phenyl]-N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 161278176 |
| Molecular Formula | C39H49N7O6 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.37 |
| IUPAC Name | 4-[3-[(2R)-4-[4-(aminomethyl)cyclohexyl]-4-oxo-2-[[4-(2H-tetrazol-5-yl)phenyl]carbamoyl]butyl]phenyl]-N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCCOCCOCCO)ccc1-c1cccc(C[C@H](CC(=O)C2CCC(CN)CC2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)c1 |
| InChI | InChI=1S/C39H49N7O6/c1-26-21-32(38(49)41-15-17-51-19-20-52-18-16-47)11-14-35(26)31-4-2-3-28(22-31)23-33(24-36(48)29-7-5-27(25-40)6-8-29)39(50)42-34-12-9-30(10-13-34)37-43-45-46-44-37/h2-4,9-14,21-22,27,29,33,47H,5-8,15-20,23-25,40H2,1H3,(H,41,49)(H,42,50)(H,43,44,45,46)/t27?,29?,33-/m1/s1 |
| InChIKey | VESJNOGEBBJILV-JTHIIOPFSA-N |
| XLogP | 4.12 |
| TPSA | 194.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|