C43H56N8O5 — CID 159404283
tert-butyl N-[[4-[(3R)-3-[[3-[3-[2-(diethylamino)ethylcarbamoyl]phenyl]phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate (PubChem CID 159404283) has the molecular formula C43H56N8O5 and a molecular weight of 764.97 g/mol. Its IUPAC name is tert-butyl N-[[4-[(3R)-3-[[3-[3-[2-(diethylamino)ethylcarbamoyl]phenyl]phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(3R)-3-[[3-[3-[2-(diethylamino)ethylcarbamoyl]phenyl]phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 159404283 |
| Molecular Formula | C43H56N8O5 |
| Molecular Weight | 764.97 g/mol |
| Exact Mass | 764.44 |
| IUPAC Name | tert-butyl N-[[4-[(3R)-3-[[3-[3-[2-(diethylamino)ethylcarbamoyl]phenyl]phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate |
| SMILES | CCN(CC)CCNC(=O)c1cccc(-c2cccc(C[C@H](CC(=O)C3CCC(CNC(=O)OC(C)(C)C)CC3)C(=O)Nc3ccc(-c4nn[nH]n4)cc3)c2)c1 |
| InChI | InChI=1S/C43H56N8O5/c1-6-51(7-2)23-22-44-40(53)35-13-9-12-34(26-35)33-11-8-10-30(24-33)25-36(41(54)46-37-20-18-32(19-21-37)39-47-49-50-48-39)27-38(52)31-16-14-29(15-17-31)28-45-42(55)56-43(3,4)5/h8-13,18-21,24,26,29,31,36H,6-7,14-17,22-23,25,27-28H2,1-5H3,(H,44,53)(H,45,55)(H,46,54)(H,47,48,49,50)/t29?,31?,36-/m1/s1 |
| InChIKey | LNTCPLSZYOQDEL-JGRUXWNESA-N |
| XLogP | 6.69 |
| TPSA | 171.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.97 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |