C40H48N6O6S — CID 159822825
tert-butyl N-[[4-[(3R)-3-[[3-[3-(cyclopropylmethylsulfonyl)phenyl]phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate (PubChem CID 159822825) has the molecular formula C40H48N6O6S and a molecular weight of 740.93 g/mol. Its IUPAC name is tert-butyl N-[[4-[(3R)-3-[[3-[3-(cyclopropylmethylsulfonyl)phenyl]phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(3R)-3-[[3-[3-(cyclopropylmethylsulfonyl)phenyl]phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 159822825 |
| Molecular Formula | C40H48N6O6S |
| Molecular Weight | 740.93 g/mol |
| Exact Mass | 740.34 |
| IUPAC Name | tert-butyl N-[[4-[(3R)-3-[[3-[3-(cyclopropylmethylsulfonyl)phenyl]phenyl]methyl]-4-oxo-4-[4-(2H-tetrazol-5-yl)anilino]butanoyl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(C(=O)CC(Cc2cccc(-c3cccc(S(=O)(=O)CC4CC4)c3)c2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C40H48N6O6S/c1-40(2,3)52-39(49)41-24-26-12-14-29(15-13-26)36(47)23-33(38(48)42-34-18-16-30(17-19-34)37-43-45-46-44-37)21-28-6-4-7-31(20-28)32-8-5-9-35(22-32)53(50,51)25-27-10-11-27/h4-9,16-20,22,26-27,29,33H,10-15,21,23-25H2,1-3H3,(H,41,49)(H,42,48)(H,43,44,45,46) |
| InChIKey | NMLOKIYVJOCIAU-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 173.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.93 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |