C36H43N5O3 — CID 160612816
(2R)-2-[[4-[4-(4-aminobutanoyl)-2-methylphenyl]phenyl]methyl]-4-[4-(aminomethyl)cyclohexyl]-N-(1H-indazol-6-yl)-4-oxobutanamide (PubChem CID 160612816) has the molecular formula C36H43N5O3 and a molecular weight of 593.77 g/mol. Its IUPAC name is (2R)-2-[[4-[4-(4-aminobutanoyl)-2-methylphenyl]phenyl]methyl]-4-[4-(aminomethyl)cyclohexyl]-N-(1H-indazol-6-yl)-4-oxobutanamide.
| Compound Name | (2R)-2-[[4-[4-(4-aminobutanoyl)-2-methylphenyl]phenyl]methyl]-4-[4-(aminomethyl)cyclohexyl]-N-(1H-indazol-6-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 160612816 |
| Molecular Formula | C36H43N5O3 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | (2R)-2-[[4-[4-(4-aminobutanoyl)-2-methylphenyl]phenyl]methyl]-4-[4-(aminomethyl)cyclohexyl]-N-(1H-indazol-6-yl)-4-oxobutanamide |
| SMILES | Cc1cc(C(=O)CCCN)ccc1-c1ccc(CC(CC(=O)C2CCC(CN)CC2)C(=O)Nc2ccc3cn[nH]c3c2)cc1 |
| InChI | InChI=1S/C36H43N5O3/c1-23-17-28(34(42)3-2-16-37)13-15-32(23)26-8-4-24(5-9-26)18-30(19-35(43)27-10-6-25(21-38)7-11-27)36(44)40-31-14-12-29-22-39-41-33(29)20-31/h4-5,8-9,12-15,17,20,22,25,27,30H,2-3,6-7,10-11,16,18-19,21,37-38H2,1H3,(H,39,41)(H,40,44) |
| InChIKey | RFRXNVGOWVANSO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |