C15H23N3 — CID 123990513
N'-[(2Z,4Z)-6-cyano-3-ethyl-7,8-dimethylnona-2,4,6-trien-4-yl]methanimidamide (PubChem CID 123990513) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is N'-[(2Z,4Z)-6-cyano-3-ethyl-7,8-dimethylnona-2,4,6-trien-4-yl]methanimidamide.
| Compound Name | N'-[(2Z,4Z)-6-cyano-3-ethyl-7,8-dimethylnona-2,4,6-trien-4-yl]methanimidamide |
|---|---|
| PubChem CID | 123990513 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N'-[(2Z,4Z)-6-cyano-3-ethyl-7,8-dimethylnona-2,4,6-trien-4-yl]methanimidamide |
| SMILES | C/C=C(CC)\C(=C\C(C#N)=C(C)C(C)C)\N=C\N |
| InChI | InChI=1S/C15H23N3/c1-6-13(7-2)15(18-10-17)8-14(9-16)12(5)11(3)4/h6,8,10-11H,7H2,1-5H3,(H2,17,18)/b13-6-,14-12?,15-8- |
| InChIKey | DGNIKDHHRMFWEH-VWWMEHNLSA-N |
| XLogP | 3.71 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|