C10H16N2 — CID 143256174
N'-[(3Z)-3-ethyl-5-methylhexa-1,3,5-trien-2-yl]methanimidamide (PubChem CID 143256174) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N'-[(3Z)-3-ethyl-5-methylhexa-1,3,5-trien-2-yl]methanimidamide.
| Compound Name | N'-[(3Z)-3-ethyl-5-methylhexa-1,3,5-trien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 143256174 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N'-[(3Z)-3-ethyl-5-methylhexa-1,3,5-trien-2-yl]methanimidamide |
| SMILES | C=C(C)/C=C(/CC)C(=C)/N=C/N |
| InChI | InChI=1S/C10H16N2/c1-5-10(6-8(2)3)9(4)12-7-11/h6-7H,2,4-5H2,1,3H3,(H2,11,12)/b10-6- |
| InChIKey | KXXCPPHNAIVKNN-POHAHGRESA-N |
| XLogP | 2.40 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|