C21H23ClF3N7O — CID 123990626
5-chloro-N-[4-methyl-6-[[6-(trifluoromethyl)pyridazin-3-yl]amino]hexyl]-2-(triazol-2-yl)benzamide (PubChem CID 123990626) has the molecular formula C21H23ClF3N7O and a molecular weight of 481.91 g/mol. Its IUPAC name is 5-chloro-N-[4-methyl-6-[[6-(trifluoromethyl)pyridazin-3-yl]amino]hexyl]-2-(triazol-2-yl)benzamide.
| Compound Name | 5-chloro-N-[4-methyl-6-[[6-(trifluoromethyl)pyridazin-3-yl]amino]hexyl]-2-(triazol-2-yl)benzamide |
|---|---|
| PubChem CID | 123990626 |
| Molecular Formula | C21H23ClF3N7O |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 5-chloro-N-[4-methyl-6-[[6-(trifluoromethyl)pyridazin-3-yl]amino]hexyl]-2-(triazol-2-yl)benzamide |
| SMILES | CC(CCCNC(=O)c1cc(Cl)ccc1-n1nccn1)CCNc1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C21H23ClF3N7O/c1-14(8-10-26-19-7-6-18(30-31-19)21(23,24)25)3-2-9-27-20(33)16-13-15(22)4-5-17(16)32-28-11-12-29-32/h4-7,11-14H,2-3,8-10H2,1H3,(H,26,31)(H,27,33) |
| InChIKey | ZLVLZBGPNZIFOL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|