C20H23ClFN7O — CID 123162972
N-[6-[(5-chloropyrimidin-2-yl)amino]-4-methylhexyl]-2-fluoro-6-(triazol-2-yl)benzamide (PubChem CID 123162972) has the molecular formula C20H23ClFN7O and a molecular weight of 431.90 g/mol. Its IUPAC name is N-[6-[(5-chloropyrimidin-2-yl)amino]-4-methylhexyl]-2-fluoro-6-(triazol-2-yl)benzamide.
| Compound Name | N-[6-[(5-chloropyrimidin-2-yl)amino]-4-methylhexyl]-2-fluoro-6-(triazol-2-yl)benzamide |
|---|---|
| PubChem CID | 123162972 |
| Molecular Formula | C20H23ClFN7O |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[6-[(5-chloropyrimidin-2-yl)amino]-4-methylhexyl]-2-fluoro-6-(triazol-2-yl)benzamide |
| SMILES | CC(CCCNC(=O)c1c(F)cccc1-n1nccn1)CCNc1ncc(Cl)cn1 |
| InChI | InChI=1S/C20H23ClFN7O/c1-14(7-9-24-20-25-12-15(21)13-26-20)4-3-8-23-19(30)18-16(22)5-2-6-17(18)29-27-10-11-28-29/h2,5-6,10-14H,3-4,7-9H2,1H3,(H,23,30)(H,24,25,26) |
| InChIKey | UALHONTXFYPFOE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|