C8H10N2 — CID 123991323
5-methylidene-1,2,4,6-tetrahydroindazole (PubChem CID 123991323) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 5-methylidene-1,2,4,6-tetrahydroindazole.
| Compound Name | 5-methylidene-1,2,4,6-tetrahydroindazole |
|---|---|
| PubChem CID | 123991323 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 5-methylidene-1,2,4,6-tetrahydroindazole |
| SMILES | C=C1CC=C2NNC=C2C1 |
| InChI | InChI=1S/C8H10N2/c1-6-2-3-8-7(4-6)5-9-10-8/h3,5,9-10H,1-2,4H2 |
| InChIKey | BDXGZYLACBAYOH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|