3-bromoindazole-1,6-dicarboxylic acid

C9H5BrN2O4 — CID 123994714

IUPAC3-bromoindazole-1,6-dicarboxylic acid
SMILESO=C(O)c1ccc2c(Br)nn(C(=O)O)c2c1
InChIInChI=1S/C9H5BrN2O4/c10-7-5-2-1-4(8(13)14)3-6(5)12(11-7)9(15)16/h1-3H,(H,13,14)(H,15,16)
InChIKeyFOJSOBMZNMYZHF-UHFFFAOYSA-N
MW285.05 g/mol
LogP2.02
Rot. Bonds1

About 3-bromoindazole-1,6-dicarboxylic acid

3-bromoindazole-1,6-dicarboxylic acid (PubChem CID 123994714) has the molecular formula C9H5BrN2O4 and a molecular weight of 285.05 g/mol. Its IUPAC name is 3-bromoindazole-1,6-dicarboxylic acid.

Molecular Properties

Compound Name3-bromoindazole-1,6-dicarboxylic acid
PubChem CID123994714
Molecular FormulaC9H5BrN2O4
Molecular Weight285.05 g/mol
Exact Mass283.94
IUPAC Name3-bromoindazole-1,6-dicarboxylic acid
SMILESO=C(O)c1ccc2c(Br)nn(C(=O)O)c2c1
InChIInChI=1S/C9H5BrN2O4/c10-7-5-2-1-4(8(13)14)3-6(5)12(11-7)9(15)16/h1-3H,(H,13,14)(H,15,16)
InChIKeyFOJSOBMZNMYZHF-UHFFFAOYSA-N
XLogP2.02
TPSA92.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.05
LogP ≤ 52.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-bromoindazole-1,6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromoindazole-1,6-dicarboxylic acid?
The IUPAC name of 3-bromoindazole-1,6-dicarboxylic acid (CID 123994714) is 3-bromoindazole-1,6-dicarboxylic acid.
What is the SMILES notation for 3-bromoindazole-1,6-dicarboxylic acid?
The canonical SMILES for 3-bromoindazole-1,6-dicarboxylic acid is O=C(O)c1ccc2c(Br)nn(C(=O)O)c2c1.
What is the InChIKey of 3-bromoindazole-1,6-dicarboxylic acid?
The InChIKey is FOJSOBMZNMYZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN2O4/c10-7-5-2-1-4(8(13)14)3-6(5)12(11-7)9(15)16/h1-3H,(H,13,14)(H,15,16).
What are the key properties of 3-bromoindazole-1,6-dicarboxylic acid?
3-bromoindazole-1,6-dicarboxylic acid has a molecular weight of 285.05 g/mol, XLogP of 2.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoindazole-1,6-dicarboxylic acid is sourced from PubChem (CID 123994714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).