C10H7NO5 — CID 130298853
1-methyl-2,4-dioxo-3,1-benzoxazine-7-carboxylic acid (PubChem CID 130298853) has the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. Its IUPAC name is 1-methyl-2,4-dioxo-3,1-benzoxazine-7-carboxylic acid.
| Compound Name | 1-methyl-2,4-dioxo-3,1-benzoxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 130298853 |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 1-methyl-2,4-dioxo-3,1-benzoxazine-7-carboxylic acid |
| SMILES | Cn1c(=O)oc(=O)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C10H7NO5/c1-11-7-4-5(8(12)13)2-3-6(7)9(14)16-10(11)15/h2-4H,1H3,(H,12,13) |
| InChIKey | NVEYHHPSSLRNJN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |