C14H12O7S2 — CID 123996000
[2-(benzenesulfonyloxy)-4-methylphenyl]-oxomethanesulfonic acid (PubChem CID 123996000) has the molecular formula C14H12O7S2 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-(benzenesulfonyloxy)-4-methylphenyl]-oxomethanesulfonic acid.
| Compound Name | [2-(benzenesulfonyloxy)-4-methylphenyl]-oxomethanesulfonic acid |
|---|---|
| PubChem CID | 123996000 |
| Molecular Formula | C14H12O7S2 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | [2-(benzenesulfonyloxy)-4-methylphenyl]-oxomethanesulfonic acid |
| SMILES | Cc1ccc(C(=O)S(=O)(=O)O)c(OS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C14H12O7S2/c1-10-7-8-12(14(15)22(16,17)18)13(9-10)21-23(19,20)11-5-3-2-4-6-11/h2-9H,1H3,(H,16,17,18) |
| InChIKey | RENWWWQKEVSLFK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|