C19H29ClO3 — CID 123997383
3-but-2-en-2-yl-8-chloro-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]nona-3,5,7-trienoic acid (PubChem CID 123997383) has the molecular formula C19H29ClO3 and a molecular weight of 340.89 g/mol. Its IUPAC name is 3-but-2-en-2-yl-8-chloro-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]nona-3,5,7-trienoic acid.
| Compound Name | 3-but-2-en-2-yl-8-chloro-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]nona-3,5,7-trienoic acid |
|---|---|
| PubChem CID | 123997383 |
| Molecular Formula | C19H29ClO3 |
| Molecular Weight | 340.89 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-but-2-en-2-yl-8-chloro-4,5-dimethyl-2-[(2-methylpropan-2-yl)oxy]nona-3,5,7-trienoic acid |
| SMILES | CC=C(C)C(=C(C)C(C)=CC=C(C)Cl)C(OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H29ClO3/c1-9-12(2)16(15(5)13(3)10-11-14(4)20)17(18(21)22)23-19(6,7)8/h9-11,17H,1-8H3,(H,21,22) |
| InChIKey | VQZSYEXLHNJWKI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.89 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|