C8H9Cl2N — CID 123997859
7,8-dichloro-6-methyl-4,5-dihydroazocine (PubChem CID 123997859) has the molecular formula C8H9Cl2N and a molecular weight of 190.07 g/mol. Its IUPAC name is 7,8-dichloro-6-methyl-4,5-dihydroazocine.
| Compound Name | 7,8-dichloro-6-methyl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 123997859 |
| Molecular Formula | C8H9Cl2N |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | 7,8-dichloro-6-methyl-4,5-dihydroazocine |
| SMILES | CC1=C(Cl)/C(Cl)=N\C=CCC1 |
| InChI | InChI=1S/C8H9Cl2N/c1-6-4-2-3-5-11-8(10)7(6)9/h3,5H,2,4H2,1H3/b5-3?,7-6?,11-8+ |
| InChIKey | GFQWRYMKDNCVBP-QLHDIZFLSA-N |
| XLogP | 3.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |