C10H14ClN — CID 143344512
(Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride (PubChem CID 143344512) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride.
| Compound Name | (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride |
|---|---|
| PubChem CID | 143344512 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride |
| SMILES | C=C/N=C(Cl)/C=C(\C=C)CCC |
| InChI | InChI=1S/C10H14ClN/c1-4-7-9(5-2)8-10(11)12-6-3/h5-6,8H,2-4,7H2,1H3/b9-8+,12-10- |
| InChIKey | GZABXUAZPUKFDG-ZLNDROGTSA-N |
| XLogP | 3.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|