(Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride

C10H14ClN — CID 143344512

IUPAC(Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride
SMILESC=C/N=C(Cl)/C=C(\C=C)CCC
InChIInChI=1S/C10H14ClN/c1-4-7-9(5-2)8-10(11)12-6-3/h5-6,8H,2-4,7H2,1H3/b9-8+,12-10-
InChIKeyGZABXUAZPUKFDG-ZLNDROGTSA-N
MW183.68 g/mol
LogP3.68
Rot. Bonds5

About (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride

(Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride (PubChem CID 143344512) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride.

Molecular Properties

Compound Name(Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride
PubChem CID143344512
Molecular FormulaC10H14ClN
Molecular Weight183.68 g/mol
Exact Mass183.08
IUPAC Name(Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride
SMILESC=C/N=C(Cl)/C=C(\C=C)CCC
InChIInChI=1S/C10H14ClN/c1-4-7-9(5-2)8-10(11)12-6-3/h5-6,8H,2-4,7H2,1H3/b9-8+,12-10-
InChIKeyGZABXUAZPUKFDG-ZLNDROGTSA-N
XLogP3.68
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.68
LogP ≤ 53.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride?
The IUPAC name of (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride (CID 143344512) is (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride.
What is the SMILES notation for (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride?
The canonical SMILES for (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride is C=C/N=C(Cl)/C=C(\C=C)CCC.
What is the InChIKey of (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride?
The InChIKey is GZABXUAZPUKFDG-ZLNDROGTSA-N. The full InChI is InChI=1S/C10H14ClN/c1-4-7-9(5-2)8-10(11)12-6-3/h5-6,8H,2-4,7H2,1H3/b9-8+,12-10-.
What are the key properties of (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride?
(Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride has a molecular weight of 183.68 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,3-bis(ethenyl)hex-2-enimidoyl chloride is sourced from PubChem (CID 143344512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).