C8H10ClN — CID 163799912
2-chloro-3-methyl-4,5-dihydroazocine (PubChem CID 163799912) has the molecular formula C8H10ClN and a molecular weight of 155.63 g/mol. Its IUPAC name is 2-chloro-3-methyl-4,5-dihydroazocine.
| Compound Name | 2-chloro-3-methyl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 163799912 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 2-chloro-3-methyl-4,5-dihydroazocine |
| SMILES | CC1=C(Cl)N=CC=CCC1 |
| InChI | InChI=1S/C8H10ClN/c1-7-5-3-2-4-6-10-8(7)9/h2,4,6H,3,5H2,1H3 |
| InChIKey | NEBPNADVVTUVFF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|