C30H21BN4O2 — CID 123998019
[3-[2-isoquinolin-4-yl-6-(4-pyridin-2-ylphenyl)pyrimidin-4-yl]phenyl]boronic acid (PubChem CID 123998019) has the molecular formula C30H21BN4O2 and a molecular weight of 480.34 g/mol. Its IUPAC name is [3-[2-isoquinolin-4-yl-6-(4-pyridin-2-ylphenyl)pyrimidin-4-yl]phenyl]boronic acid.
| Compound Name | [3-[2-isoquinolin-4-yl-6-(4-pyridin-2-ylphenyl)pyrimidin-4-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 123998019 |
| Molecular Formula | C30H21BN4O2 |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [3-[2-isoquinolin-4-yl-6-(4-pyridin-2-ylphenyl)pyrimidin-4-yl]phenyl]boronic acid |
| SMILES | OB(O)c1cccc(-c2cc(-c3ccc(-c4ccccn4)cc3)nc(-c3cncc4ccccc34)n2)c1 |
| InChI | InChI=1S/C30H21BN4O2/c36-31(37)24-8-5-7-22(16-24)29-17-28(21-13-11-20(12-14-21)27-10-3-4-15-33-27)34-30(35-29)26-19-32-18-23-6-1-2-9-25(23)26/h1-19,36-37H |
| InChIKey | GBTFZJVRXFDZJX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|