C25H29ClN10 — CID 123998180
4-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-N-[4-chloro-3-(5-cyclopropyltetrazol-1-yl)phenyl]-5-isocyanopyrimidine-2,4-diamine (PubChem CID 123998180) has the molecular formula C25H29ClN10 and a molecular weight of 505.03 g/mol. Its IUPAC name is 4-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-N-[4-chloro-3-(5-cyclopropyltetrazol-1-yl)phenyl]-5-isocyanopyrimidine-2,4-diamine.
| Compound Name | 4-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-N-[4-chloro-3-(5-cyclopropyltetrazol-1-yl)phenyl]-5-isocyanopyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 123998180 |
| Molecular Formula | C25H29ClN10 |
| Molecular Weight | 505.03 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 4-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-N-[4-chloro-3-(5-cyclopropyltetrazol-1-yl)phenyl]-5-isocyanopyrimidine-2,4-diamine |
| SMILES | [C-]#[N+]c1cnc(Nc2ccc(Cl)c(-n3nnnc3C3CC3)c2)nc1NC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C25H29ClN10/c1-27-20-15-29-25(31-23(20)28-14-17-5-4-12-35-11-3-2-6-21(17)35)30-18-9-10-19(26)22(13-18)36-24(16-7-8-16)32-33-34-36/h9-10,13,15-17,21H,2-8,11-12,14H2,(H2,28,29,30,31)/t17-,21+/m0/s1 |
| InChIKey | WEODBJORXMAVHY-LAUBAEHRSA-N |
| XLogP | 4.95 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.03 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|