C22H28N6 — CID 90199014
3-[[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-5-methylpyrimidin-2-yl]amino]benzonitrile (PubChem CID 90199014) has the molecular formula C22H28N6 and a molecular weight of 376.51 g/mol. Its IUPAC name is 3-[[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-5-methylpyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 3-[[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-5-methylpyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 90199014 |
| Molecular Formula | C22H28N6 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 3-[[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-5-methylpyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cnc(Nc2cccc(C#N)c2)nc1NC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C22H28N6/c1-16-14-25-22(26-19-8-4-6-17(12-19)13-23)27-21(16)24-15-18-7-5-11-28-10-3-2-9-20(18)28/h4,6,8,12,14,18,20H,2-3,5,7,9-11,15H2,1H3,(H2,24,25,26,27)/t18-,20+/m0/s1 |
| InChIKey | YMWHKBUVAYDPOG-AZUAARDMSA-N |
| XLogP | 4.08 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |