C23H31N9 — CID 154352014
4-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-methyl-2-N-[4-methyl-2-(tetrazol-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 154352014) has the molecular formula C23H31N9 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-methyl-2-N-[4-methyl-2-(tetrazol-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-methyl-2-N-[4-methyl-2-(tetrazol-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154352014 |
| Molecular Formula | C23H31N9 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 4-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-methyl-2-N-[4-methyl-2-(tetrazol-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2ncc(C)c(NC[C@@H]3CCCN4CCCC[C@H]34)n2)c(-n2cnnn2)c1 |
| InChI | InChI=1S/C23H31N9/c1-16-8-9-19(21(12-16)32-15-26-29-30-32)27-23-25-13-17(2)22(28-23)24-14-18-6-5-11-31-10-4-3-7-20(18)31/h8-9,12-13,15,18,20H,3-7,10-11,14H2,1-2H3,(H2,24,25,27,28)/t18-,20+/m0/s1 |
| InChIKey | VZRROKLSELNKJY-AZUAARDMSA-N |
| XLogP | 3.49 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |