C25H31FN6O — CID 90198867
5-[[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-5-methoxypyrimidin-2-yl]amino]-2-cyclopropyl-4-fluorobenzonitrile (PubChem CID 90198867) has the molecular formula C25H31FN6O and a molecular weight of 450.56 g/mol. Its IUPAC name is 5-[[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-5-methoxypyrimidin-2-yl]amino]-2-cyclopropyl-4-fluorobenzonitrile.
| Compound Name | 5-[[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-5-methoxypyrimidin-2-yl]amino]-2-cyclopropyl-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 90198867 |
| Molecular Formula | C25H31FN6O |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 5-[[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-5-methoxypyrimidin-2-yl]amino]-2-cyclopropyl-4-fluorobenzonitrile |
| SMILES | COc1cnc(Nc2cc(C#N)c(C3CC3)cc2F)nc1NC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C25H31FN6O/c1-33-23-15-29-25(30-21-11-18(13-27)19(12-20(21)26)16-7-8-16)31-24(23)28-14-17-5-4-10-32-9-3-2-6-22(17)32/h11-12,15-17,22H,2-10,14H2,1H3,(H2,28,29,30,31)/t17-,22+/m0/s1 |
| InChIKey | COXKDAHZJNACDK-HTAPYJJXSA-N |
| XLogP | 4.79 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |