C24H32N10O2 — CID 90199079
4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-2-[4-methoxy-3-(5-methyltetrazol-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 90199079) has the molecular formula C24H32N10O2 and a molecular weight of 492.59 g/mol. Its IUPAC name is 4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-2-[4-methoxy-3-(5-methyltetrazol-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-2-[4-methoxy-3-(5-methyltetrazol-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90199079 |
| Molecular Formula | C24H32N10O2 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-2-[4-methoxy-3-(5-methyltetrazol-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(Nc2ncc(C(N)=O)c(NC[C@@H]3CCCN4CCCC[C@H]34)n2)cc1-n1nnnc1C |
| InChI | InChI=1S/C24H32N10O2/c1-15-30-31-32-34(15)20-12-17(8-9-21(20)36-2)28-24-27-14-18(22(25)35)23(29-24)26-13-16-6-5-11-33-10-4-3-7-19(16)33/h8-9,12,14,16,19H,3-7,10-11,13H2,1-2H3,(H2,25,35)(H2,26,27,28,29)/t16-,19+/m0/s1 |
| InChIKey | NSLLVJFGXFBCKX-QFBILLFUSA-N |
| XLogP | 2.29 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |