About N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide
N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide (PubChem CID 1244950) has the molecular formula C18H16N2O4S
and a molecular weight of 356.40 g/mol. Its IUPAC name is N-[4-[methyl(phenyl)sulfamoyl]phenyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide |
| PubChem CID | 1244950 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-[4-[methyl(phenyl)sulfamoyl]phenyl]furan-2-carboxamide |
| SMILES | CN(C1=CC=CC=C1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CO3 |
| InChI | InChI=1S/C18H16N2O4S/c1-20(15-6-3-2-4-7-15)25(22,23)16-11-9-14(10-12-16)19-18(21)17-8-5-13-24-17/h2-13H,1H3,(H,19,21) |
| InChIKey | YDLXVACJVUFWFZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 546 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide?
The IUPAC name of N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide (CID 1244950) is N-[4-[methyl(phenyl)sulfamoyl]phenyl]furan-2-carboxamide.
What is the SMILES notation for N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide?
The canonical SMILES for N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide is CN(C1=CC=CC=C1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CO3.
What is the InChIKey of N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide?
The InChIKey is YDLXVACJVUFWFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4S/c1-20(15-6-3-2-4-7-15)25(22,23)16-11-9-14(10-12-16)19-18(21)17-8-5-13-24-17/h2-13H,1H3,(H,19,21).
What are the key properties of N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide?
N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide has a molecular weight of 356.40 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-{[methyl(phenyl)amino]sulfonyl}phenyl)-2-furamide is sourced from PubChem (CID 1244950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).