C16H8F3N3O — CID 124504838
2-[(5R)-3-cyano-4-methyl-5-phenyl-5-(trifluoromethyl)furan-2-ylidene]propanedinitrile (PubChem CID 124504838) has the molecular formula C16H8F3N3O and a molecular weight of 315.25 g/mol. Its IUPAC name is 2-[(5R)-3-cyano-4-methyl-5-phenyl-5-(trifluoromethyl)furan-2-ylidene]propanedinitrile.
| Compound Name | 2-[(5R)-3-cyano-4-methyl-5-phenyl-5-(trifluoromethyl)furan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 124504838 |
| Molecular Formula | C16H8F3N3O |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[(5R)-3-cyano-4-methyl-5-phenyl-5-(trifluoromethyl)furan-2-ylidene]propanedinitrile |
| SMILES | CC1=C(C#N)C(=C(C#N)C#N)O[C@@]1(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H8F3N3O/c1-10-13(9-22)14(11(7-20)8-21)23-15(10,16(17,18)19)12-5-3-2-4-6-12/h2-6H,1H3/t15-/m0/s1 |
| InChIKey | HALXLBYMOUPGRG-HNNXBMFYSA-N |
| XLogP | 3.62 |
| TPSA | 80.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|