C14H16N2O2S — CID 124516286
(4S)-N-(2-methyl-1,3-dihydroinden-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 124516286) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is (4S)-N-(2-methyl-1,3-dihydroinden-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-N-(2-methyl-1,3-dihydroinden-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 124516286 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (4S)-N-(2-methyl-1,3-dihydroinden-2-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1(NC(=O)[C@H]2CSC(=O)N2)Cc2ccccc2C1 |
| InChI | InChI=1S/C14H16N2O2S/c1-14(6-9-4-2-3-5-10(9)7-14)16-12(17)11-8-19-13(18)15-11/h2-5,11H,6-8H2,1H3,(H,15,18)(H,16,17)/t11-/m1/s1 |
| InChIKey | UFFOISLJKOGCGR-LLVKDONJSA-N |
| XLogP | 1.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|