C14H16ClN3S — CID 124516669
(3R)-3-(4-chlorophenyl)-4-(1H-imidazol-5-ylmethyl)thiomorpholine (PubChem CID 124516669) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-4-(1H-imidazol-5-ylmethyl)thiomorpholine.
| Compound Name | (3R)-3-(4-chlorophenyl)-4-(1H-imidazol-5-ylmethyl)thiomorpholine |
|---|---|
| PubChem CID | 124516669 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-4-(1H-imidazol-5-ylmethyl)thiomorpholine |
| SMILES | Clc1ccc([C@@H]2CSCCN2Cc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C14H16ClN3S/c15-12-3-1-11(2-4-12)14-9-19-6-5-18(14)8-13-7-16-10-17-13/h1-4,7,10,14H,5-6,8-9H2,(H,16,17)/t14-/m0/s1 |
| InChIKey | ASAUZJCZNUYBMH-AWEZNQCLSA-N |
| XLogP | 3.35 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |