C7H12FNO — CID 124520340
(3aR,4S,5R,6aS)-5-fluoro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 124520340) has the molecular formula C7H12FNO and a molecular weight of 145.18 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-5-fluoro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aR,4S,5R,6aS)-5-fluoro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 124520340 |
| Molecular Formula | C7H12FNO |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (3aR,4S,5R,6aS)-5-fluoro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | O[C@H]1[C@H]2CNC[C@H]2C[C@H]1F |
| InChI | InChI=1S/C7H12FNO/c8-6-1-4-2-9-3-5(4)7(6)10/h4-7,9-10H,1-3H2/t4-,5+,6-,7+/m1/s1 |
| InChIKey | HEVILJNXCLTNQZ-UCROKIRRSA-N |
| XLogP | -0.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |