C6H10FN — CID 130682149
(1R,5R,6S)-5-fluoro-3-azabicyclo[4.1.0]heptane (PubChem CID 130682149) has the molecular formula C6H10FN and a molecular weight of 115.15 g/mol. Its IUPAC name is (1R,5R,6S)-5-fluoro-3-azabicyclo[4.1.0]heptane.
| Compound Name | (1R,5R,6S)-5-fluoro-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 130682149 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | (1R,5R,6S)-5-fluoro-3-azabicyclo[4.1.0]heptane |
| SMILES | F[C@H]1CNC[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C6H10FN/c7-6-3-8-2-4-1-5(4)6/h4-6,8H,1-3H2/t4-,5-,6-/m0/s1 |
| InChIKey | MDUJFLHUXRIJHZ-ZLUOBGJFSA-N |
| XLogP | 0.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |