C23H46N2O2 — CID 124524414
(5R)-2,2,3,3-tetratert-butyl-5-methyl-1,4-diazepane-1-carboxylic acid (PubChem CID 124524414) has the molecular formula C23H46N2O2 and a molecular weight of 382.63 g/mol. Its IUPAC name is (5R)-2,2,3,3-tetratert-butyl-5-methyl-1,4-diazepane-1-carboxylic acid.
| Compound Name | (5R)-2,2,3,3-tetratert-butyl-5-methyl-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 124524414 |
| Molecular Formula | C23H46N2O2 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | (5R)-2,2,3,3-tetratert-butyl-5-methyl-1,4-diazepane-1-carboxylic acid |
| SMILES | C[C@@H]1CCN(C(=O)O)C(C(C)(C)C)(C(C)(C)C)C(C(C)(C)C)(C(C)(C)C)N1 |
| InChI | InChI=1S/C23H46N2O2/c1-16-14-15-25(17(26)27)23(20(8,9)10,21(11,12)13)22(24-16,18(2,3)4)19(5,6)7/h16,24H,14-15H2,1-13H3,(H,26,27)/t16-/m1/s1 |
| InChIKey | NAUMYFQISSUFQH-MRXNPFEDSA-N |
| XLogP | 6.01 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |