(2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid

C11H22N2O2 — CID 175103708

IUPAC(2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid
SMILESC[C@@H]1CN(C(=O)O)[C@@](C)(C(C)(C)C)CN1
InChIInChI=1S/C11H22N2O2/c1-8-6-13(9(14)15)11(5,7-12-8)10(2,3)4/h8,12H,6-7H2,1-5H3,(H,14,15)/t8-,11-/m1/s1
InChIKeyMIBMGMZDYUWUIW-LDYMZIIASA-N
MW214.31 g/mol
LogP1.76
Rot. Bonds

About (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid

(2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 175103708) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid.

Molecular Properties

Compound Name(2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid
PubChem CID175103708
Molecular FormulaC11H22N2O2
Molecular Weight214.31 g/mol
Exact Mass214.17
IUPAC Name(2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid
SMILESC[C@@H]1CN(C(=O)O)[C@@](C)(C(C)(C)C)CN1
InChIInChI=1S/C11H22N2O2/c1-8-6-13(9(14)15)11(5,7-12-8)10(2,3)4/h8,12H,6-7H2,1-5H3,(H,14,15)/t8-,11-/m1/s1
InChIKeyMIBMGMZDYUWUIW-LDYMZIIASA-N
XLogP1.76
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.31
LogP ≤ 51.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid?
The IUPAC name of (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid (CID 175103708) is (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid.
What is the SMILES notation for (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid?
The canonical SMILES for (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid is C[C@@H]1CN(C(=O)O)[C@@](C)(C(C)(C)C)CN1.
What is the InChIKey of (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid?
The InChIKey is MIBMGMZDYUWUIW-LDYMZIIASA-N. The full InChI is InChI=1S/C11H22N2O2/c1-8-6-13(9(14)15)11(5,7-12-8)10(2,3)4/h8,12H,6-7H2,1-5H3,(H,14,15)/t8-,11-/m1/s1.
What are the key properties of (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid?
(2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid has a molecular weight of 214.31 g/mol, XLogP of 1.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-tert-butyl-2,5-dimethylpiperazine-1-carboxylic acid is sourced from PubChem (CID 175103708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).