C14H18F2N2O — CID 82247181
(3,4-difluorophenyl)-(2,2,5-trimethylpiperazin-1-yl)methanone (PubChem CID 82247181) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(2,2,5-trimethylpiperazin-1-yl)methanone.
| Compound Name | (3,4-difluorophenyl)-(2,2,5-trimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 82247181 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (3,4-difluorophenyl)-(2,2,5-trimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(F)c(F)c2)C(C)(C)CN1 |
| InChI | InChI=1S/C14H18F2N2O/c1-9-7-18(14(2,3)8-17-9)13(19)10-4-5-11(15)12(16)6-10/h4-6,9,17H,7-8H2,1-3H3 |
| InChIKey | WEOUWSQRPAGGEO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |