C18H20O — CID 124525561
(1R,5S,7S,11R)-6,12-di(propan-2-ylidene)-3-oxaheptacyclo[6.4.1.02,4.02,7.04,11.05,9.010,13]tridecane (PubChem CID 124525561) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is (1R,5S,7S,11R)-6,12-di(propan-2-ylidene)-3-oxaheptacyclo[6.4.1.02,4.02,7.04,11.05,9.010,13]tridecane.
| Compound Name | (1R,5S,7S,11R)-6,12-di(propan-2-ylidene)-3-oxaheptacyclo[6.4.1.02,4.02,7.04,11.05,9.010,13]tridecane |
|---|---|
| PubChem CID | 124525561 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (1R,5S,7S,11R)-6,12-di(propan-2-ylidene)-3-oxaheptacyclo[6.4.1.02,4.02,7.04,11.05,9.010,13]tridecane |
| SMILES | CC(C)=C1[C@@H]2C3C4C5C3[C@@H]1C13OC21C4C(=C(C)C)[C@@H]53 |
| InChI | InChI=1S/C18H20O/c1-5(2)7-13-9-10-12-11(9)15-8(6(3)4)16(12)18(14(7)10)17(13,15)19-18/h9-16H,1-4H3/t9?,10?,11?,12?,13-,14-,15+,16?,17?,18?/m1/s1 |
| InChIKey | CJXJODFGKUQNAV-OOSQZMIPSA-N |
| XLogP | 3.18 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|