C31H22BrN5O2S — CID 124529570
3-bromo-N-[(Z)-[5-[[5-(naphthalen-1-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]furan-2-yl]methylideneamino]benzamide (PubChem CID 124529570) has the molecular formula C31H22BrN5O2S and a molecular weight of 608.52 g/mol. Its IUPAC name is 3-bromo-N-[(Z)-[5-[[5-(naphthalen-1-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]furan-2-yl]methylideneamino]benzamide.
| Compound Name | 3-bromo-N-[(Z)-[5-[[5-(naphthalen-1-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 124529570 |
| Molecular Formula | C31H22BrN5O2S |
| Molecular Weight | 608.52 g/mol |
| Exact Mass | 607.07 |
| IUPAC Name | 3-bromo-N-[(Z)-[5-[[5-(naphthalen-1-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(Sc2nnc(Cc3cccc4ccccc34)n2-c2ccccc2)o1)c1cccc(Br)c1 |
| InChI | InChI=1S/C31H22BrN5O2S/c32-24-12-7-11-23(18-24)30(38)35-33-20-26-16-17-29(39-26)40-31-36-34-28(37(31)25-13-2-1-3-14-25)19-22-10-6-9-21-8-4-5-15-27(21)22/h1-18,20H,19H2,(H,35,38)/b33-20- |
| InChIKey | NJTGEVIGRGTYAL-UCMJSZAQSA-N |
| XLogP | 7.28 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.52 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|