C25H22BrClN2O2S — CID 124532064
(5Z)-5-[[3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one (PubChem CID 124532064) has the molecular formula C25H22BrClN2O2S and a molecular weight of 529.89 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 124532064 |
| Molecular Formula | C25H22BrClN2O2S |
| Molecular Weight | 529.89 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | (5Z)-5-[[3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one |
| SMILES | CC/N=C1/S/C(=C\c2cc(Cl)c(OCc3cccc4ccccc34)c(Br)c2)C(=O)N1CC |
| InChI | InChI=1S/C25H22BrClN2O2S/c1-3-28-25-29(4-2)24(30)22(32-25)14-16-12-20(26)23(21(27)13-16)31-15-18-10-7-9-17-8-5-6-11-19(17)18/h5-14H,3-4,15H2,1-2H3/b22-14-,28-25+ |
| InChIKey | KNLLUEWLIZUWNF-NAZNCCOQSA-N |
| XLogP | 7.15 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.89 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|