C29H21N5O3S3 — CID 124534815
N-[2-[(4-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-2-(1-phenylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 124534815) has the molecular formula C29H21N5O3S3 and a molecular weight of 583.72 g/mol. Its IUPAC name is N-[2-[(4-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-2-(1-phenylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[2-[(4-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-2-(1-phenylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 124534815 |
| Molecular Formula | C29H21N5O3S3 |
| Molecular Weight | 583.72 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | N-[2-[(4-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-2-(1-phenylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2n1-c1ccccc1)Nc1ccc2nc(SCc3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C29H21N5O3S3/c35-27(18-38-28-31-23-8-4-5-9-25(23)33(28)21-6-2-1-3-7-21)30-20-12-15-24-26(16-20)40-29(32-24)39-17-19-10-13-22(14-11-19)34(36)37/h1-16H,17-18H2,(H,30,35) |
| InChIKey | ROPLHXXKKIHDLX-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.72 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|