C14H12N2O3 — CID 124536939
(1R,2S,6S,7R)-4-[(Z)-furan-2-ylmethylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 124536939) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-[(Z)-furan-2-ylmethylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-[(Z)-furan-2-ylmethylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 124536939 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (1R,2S,6S,7R)-4-[(Z)-furan-2-ylmethylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1/N=C\c1ccco1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C14H12N2O3/c17-13-11-8-3-4-9(6-8)12(11)14(18)16(13)15-7-10-2-1-5-19-10/h1-5,7-9,11-12H,6H2/b15-7-/t8-,9-,11-,12-/m0/s1 |
| InChIKey | OSVDMVXRUNQMHC-RISXYFKCSA-N |
| XLogP | 1.42 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|