C18H21N3O3 — CID 98155396
(1R,2R,6S,7R)-4-[(Z)-[5-(diethylamino)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98155396) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[(Z)-[5-(diethylamino)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[(Z)-[5-(diethylamino)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98155396 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (1R,2R,6S,7R)-4-[(Z)-[5-(diethylamino)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCN(CC)c1ccc(/C=N\N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)o1 |
| InChI | InChI=1S/C18H21N3O3/c1-3-20(4-2)14-8-7-13(24-14)10-19-21-17(22)15-11-5-6-12(9-11)16(15)18(21)23/h5-8,10-12,15-16H,3-4,9H2,1-2H3/b19-10-/t11-,12-,15-,16+/m0/s1 |
| InChIKey | NINXSHOTVGYYPD-IXCMRITISA-N |
| XLogP | 2.27 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|