C27H25Cl2N3O2S2 — CID 124542309
(E)-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 124542309) has the molecular formula C27H25Cl2N3O2S2 and a molecular weight of 558.56 g/mol. Its IUPAC name is (E)-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 124542309 |
| Molecular Formula | C27H25Cl2N3O2S2 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | (E)-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(NC(=S)NC(=O)/C=C/c3ccc(-c4cc(Cl)cc(Cl)c4)o3)c2C#N)C1 |
| InChI | InChI=1S/C27H25Cl2N3O2S2/c1-27(2,3)16-4-7-20-21(14-30)25(36-23(20)12-16)32-26(35)31-24(33)9-6-19-5-8-22(34-19)15-10-17(28)13-18(29)11-15/h5-6,8-11,13,16H,4,7,12H2,1-3H3,(H2,31,32,33,35)/b9-6+/t16-/m1/s1 |
| InChIKey | SHMWAVCVUQFSQF-YXMGTMDOSA-N |
| XLogP | 7.86 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|