C15H17NO3 — CID 124550775
(2E,4R)-2-[(1,3-benzodioxol-5-ylamino)methylidene]-4-methylcyclohexan-1-one (PubChem CID 124550775) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2E,4R)-2-[(1,3-benzodioxol-5-ylamino)methylidene]-4-methylcyclohexan-1-one.
| Compound Name | (2E,4R)-2-[(1,3-benzodioxol-5-ylamino)methylidene]-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 124550775 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2E,4R)-2-[(1,3-benzodioxol-5-ylamino)methylidene]-4-methylcyclohexan-1-one |
| SMILES | C[C@@H]1CCC(=O)/C(=C/Nc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C15H17NO3/c1-10-2-4-13(17)11(6-10)8-16-12-3-5-14-15(7-12)19-9-18-14/h3,5,7-8,10,16H,2,4,6,9H2,1H3/b11-8+/t10-/m1/s1 |
| InChIKey | MPRYIWPEWKUIQG-MXBGMFSPSA-N |
| XLogP | 3.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|